dimethyl tetrafluorosuccinate structure
|
Common Name | dimethyl tetrafluorosuccinate | ||
|---|---|---|---|---|
| CAS Number | 356-36-5 | Molecular Weight | 218.10300 | |
| Density | 1,463 g/cm3 | Boiling Point | 177-178°C | |
| Molecular Formula | C6H6F4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 72.1ºC | |
| Name | dimethyl 2,2,3,3-tetrafluorobutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1,463 g/cm3 |
|---|---|
| Boiling Point | 177-178°C |
| Molecular Formula | C6H6F4O4 |
| Molecular Weight | 218.10300 |
| Flash Point | 72.1ºC |
| Exact Mass | 218.02000 |
| PSA | 52.60000 |
| LogP | 0.60300 |
| Index of Refraction | 1.353 |
| InChIKey | RMXAYQBUNVSEPG-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(=O)OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2917190090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| DiMethyl Tetrafluorosuccinate |
| Dimethyl-tetrafluorsuccinat |
| dimethyltetrafluorosuccinate |
| MFCD00043947 |
| Dimethyl Perfluorosuccinate |
| Tetrafluor-bernsteinsaeure-dimethylester |
| Dimethyl Tetrafluorobutanedioate |
| tetrafluorosuccinic acid dimethyl ester |
| Tetrafluorobutanedioic Acid Dimethyl Ester |