4-Piperidinecarbonitrile,1-(phenylmethyl)-4-(propylamino)- structure
|
Common Name | 4-Piperidinecarbonitrile,1-(phenylmethyl)-4-(propylamino)- | ||
|---|---|---|---|---|
| CAS Number | 3560-07-4 | Molecular Weight | 257.37400 | |
| Density | 1.05g/cm3 | Boiling Point | 392.9ºC at 760mmHg | |
| Molecular Formula | C16H23N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.4ºC | |
| Name | 1-benzyl-4-(propylamino)piperidine-4-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 392.9ºC at 760mmHg |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.37400 |
| Flash Point | 191.4ºC |
| Exact Mass | 257.18900 |
| PSA | 39.06000 |
| LogP | 2.87318 |
| Index of Refraction | 1.557 |
| InChIKey | UKAHSGVHHIAEEA-UHFFFAOYSA-N |
| SMILES | CCCNC1(C#N)CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 222-621-8 |