1-[4'-(Trifluoromethyl)-4-biphenylyl]methanamine structure
|
Common Name | 1-[4'-(Trifluoromethyl)-4-biphenylyl]methanamine | ||
|---|---|---|---|---|
| CAS Number | 356058-18-9 | Molecular Weight | 251.247 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 320.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H12F3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.8±12.6 °C | |
| Name | [4-[4-(trifluoromethyl)phenyl]phenyl]methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 320.4±42.0 °C at 760 mmHg |
| Molecular Formula | C14H12F3N |
| Molecular Weight | 251.247 |
| Flash Point | 141.8±12.6 °C |
| Exact Mass | 251.092178 |
| PSA | 26.02000 |
| LogP | 3.82 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.530 |
| InChIKey | RVNFCJGQVWHMKN-UHFFFAOYSA-N |
| SMILES | NCc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| HS Code | 2921499090 |
|---|
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-aminomethyl-4'-trifluoromethyl-1,1'-biphenyl |
| [1,1'-Biphenyl]-4-methanamine, 4'-(trifluoromethyl)- |
| 4'-trifluoromethylbiphenyl-4-methylamine |
| 1-[4'-(Trifluoromethyl)-4-biphenylyl]methanamine |