2-Chloro-4'-hydroxybenzanilide structure
|
Common Name | 2-Chloro-4'-hydroxybenzanilide | ||
|---|---|---|---|---|
| CAS Number | 35607-02-4 | Molecular Weight | 247.67700 | |
| Density | 1.386g/cm3 | Boiling Point | 342.4ºC at 760 mmHg | |
| Molecular Formula | C13H10ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.9ºC | |
| Name | 2-chloro-n-(4-hydroxyphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 342.4ºC at 760 mmHg |
| Molecular Formula | C13H10ClNO2 |
| Molecular Weight | 247.67700 |
| Flash Point | 160.9ºC |
| Exact Mass | 247.04000 |
| PSA | 49.33000 |
| LogP | 3.37090 |
| Index of Refraction | 1.681 |
| InChIKey | OLWMCHGHFRPBTM-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(O)cc1)c1ccccc1Cl |
| HS Code | 2924299090 |
|---|
|
~59%
2-Chloro-4'-hyd... CAS#:35607-02-4 |
| Literature: Kumar, Anil; Narasimhan, Balasubramanian; Kumar, Devinder Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 12 p. 4113 - 4124 |
|
~%
2-Chloro-4'-hyd... CAS#:35607-02-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 27, # 10 p. 1347 - 1350 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Chlor-4'-hydroxybenzanilid |
| 2-Chloro-4'-hydroxybenzanilide |
| MFCD00020144 |