Butanoic acid,4-[[4-(aminosulfonyl)phenyl]amino]-4-oxo
![Butanoic acid,4-[[4-(aminosulfonyl)phenyl]amino]-4-oxo Structure](https://image.chemsrc.com/caspic/186/3563-14-2.png)
Butanoic acid,4-[[4-(aminosulfonyl)phenyl]amino]-4-oxo structure
|
Common Name | Butanoic acid,4-[[4-(aminosulfonyl)phenyl]amino]-4-oxo | ||
|---|---|---|---|---|
| CAS Number | 3563-14-2 | Molecular Weight | 272.27800 | |
| Density | 1.52g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-oxo-4-(4-sulfamoylanilino)butanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.52g/cm3 |
|---|---|
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.27800 |
| Exact Mass | 272.04700 |
| PSA | 134.94000 |
| LogP | 1.99140 |
| Index of Refraction | 1.622 |
| InChIKey | RXXXPZYBZLDQKP-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCC(=O)O)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2935009090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 1 | |
CAS#:108-30-5
CAS#:63-74-1
CAS#:5694-39-3
CAS#:102-14-7
CAS#:83-25-0
CAS#:5470-06-4
CAS#:858805-90-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Sulfasuccinamidum |
| Sulfasuccinamide |
| N-(4-Sulfamoyl-phenyl)-succinamidsaeure |
| 4-{3-carboxy-propionylamino}-benzene-1-sulfonamide |
| Succinylsulfanilamide |
| Sulfasuccinamida |
| 4-{3-Carboxy-propionylamino}-benzol-sulfonsaeure-(1)-amid |
| 4-Oxo-4-((4-sulfamoylphenyl)amino)butanoic acid |
| N-(4-sulfamoyl-phenyl)-succinamic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-oxo-4-(4-sulfamoylanilino)butanoic acid? |
| A: Molecular weight of 4-oxo-4-(4-sulfamoylanilino)butanoic acid is 272.27800. |
| Q: What is the polar surface area (PSA) of 4-oxo-4-(4-sulfamoylanilino)butanoic acid? |
| A: Polar surface area (PSA) of 4-oxo-4-(4-sulfamoylanilino)butanoic acid is 134.94000. |
| Q: What is the CAS number of 4-oxo-4-(4-sulfamoylanilino)butanoic acid? |
| A: CAS number of 4-oxo-4-(4-sulfamoylanilino)butanoic acid is 3563-14-2. |
| Q: What is the English name of 4-oxo-4-(4-sulfamoylanilino)butanoic acid? |
| A: The English name of 4-oxo-4-(4-sulfamoylanilino)butanoic acid is 4-oxo-4-(4-sulfamoylanilino)butanoic acid. |
| Q: What is the LogP of 4-oxo-4-(4-sulfamoylanilino)butanoic acid? |
| A: LogP of 4-oxo-4-(4-sulfamoylanilino)butanoic acid is 1.99140. |
| Q: What are the upstream materials of 4-oxo-4-(4-sulfamoylanilino)butanoic acid? |
| A: Related upstream materials(CAS) of 4-oxo-4-(4-sulfamoylanilino)butanoic acid: 108-30-5;63-74-1;5694-39-3;102-14-7;83-25-0;5470-06-4;858805-90-0. |
| Q: What is the molecular formula of 4-oxo-4-(4-sulfamoylanilino)butanoic acid? |
| A: Molecular formula of 4-oxo-4-(4-sulfamoylanilino)butanoic acid is C10H12N2O5S. |
| Q: What is the SMILES notation of 4-oxo-4-(4-sulfamoylanilino)butanoic acid? |
| A: SMILES notation of 4-oxo-4-(4-sulfamoylanilino)butanoic acid is NS(=O)(=O)c1ccc(NC(=O)CCC(=O)O)cc1. |
| Q: What English synonyms does 4-oxo-4-(4-sulfamoylanilino)butanoic acid have? |
| A: English synonyms of 4-oxo-4-(4-sulfamoylanilino)butanoic acid: Sulfasuccinamidum, Sulfasuccinamide, N-(4-Sulfamoyl-phenyl)-succinamidsaeure, 4-{3-carboxy-propionylamino}-benzene-1-sulfonamide, Succinylsulfanilamide, Sulfasuccinamida, 4-{3-Carboxy-propionylamino}-benzol-sulfonsaeure-(1)-amid, 4-Oxo-4-((4-sulfamoylphenyl)amino)butanoic acid, N-(4-sulfamoyl-phenyl)-succinamic acid. |
| Q: What is the InChIKey of 4-oxo-4-(4-sulfamoylanilino)butanoic acid? |
| A: InChIKey of 4-oxo-4-(4-sulfamoylanilino)butanoic acid is RXXXPZYBZLDQKP-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |