mordant brown 1 structure
|
Common Name | mordant brown 1 | ||
|---|---|---|---|---|
| CAS Number | 3564-15-6 | Molecular Weight | 530.46800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H17N7NaO6S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of mordant brown 1Mordant brown 1, a naphthalenesulphonic acid derivative, is an azo dye. Mordant brown 1 is also an effective and specific inhibitor of CD40-CD154 costimulatory protein-protein interaction[1]. |
| Name | Tertracid Milling Brown AR |
|---|---|
| Synonym | More Synonyms |
| Description | Mordant brown 1, a naphthalenesulphonic acid derivative, is an azo dye. Mordant brown 1 is also an effective and specific inhibitor of CD40-CD154 costimulatory protein-protein interaction[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H17N7NaO6S+ |
|---|---|
| Molecular Weight | 530.46800 |
| Exact Mass | 530.08600 |
| PSA | 230.28000 |
| LogP | 8.46190 |
| InChIKey | KHXQQMBFMDTPSD-UHFFFAOYSA-M |
| SMILES | Nc1cc(N)c(N=Nc2cccc3c(S(=O)(=O)[O-])cccc23)cc1N=Nc1cc([N+](=O)[O-])ccc1O.[Na+] |
| EINECS 222-640-1 |
| Acid leather brown ebc |
| Alizarine brown eb |
| Acid leather brown cbe |
| Mordant Brown 1 |
| C.I. Mordant Brown 1 |
| METACHROME BROWN |
| MFCD00003994 |
| Alizarol brown eb |