Aminochlorthenoxazin structure
|
Common Name | Aminochlorthenoxazin | ||
|---|---|---|---|---|
| CAS Number | 3567-76-8 | Molecular Weight | 226.66000 | |
| Density | 1.324g/cm3 | Boiling Point | 552.8ºC at 760 mmHg | |
| Molecular Formula | C10H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.1ºC | |
Use of AminochlorthenoxazinAminochlorthenoxazin is an antipyretic and analgesic agent. |
| Name | 6-amino-2-(2-chloroethyl)-2,3-dihydro-1,3-benzoxazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Aminochlorthenoxazin is an antipyretic and analgesic agent. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 552.8ºC at 760 mmHg |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66000 |
| Flash Point | 288.1ºC |
| Exact Mass | 226.05100 |
| PSA | 67.84000 |
| LogP | 1.93760 |
| Index of Refraction | 1.584 |
| InChIKey | PCYLDXMXEPSXFW-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)NC(CCCl)O2 |
| Storage condition | 2-8℃ |
| C10H11ClN2O2 |
| 6-Amino-2-chloroethyl-3,4-dihydro-2H-1,3-benzoxazin-4-one |
| Aminochlorthenoxazin |
| Aminochlorthenoxazine |