3-Methyl-4-nitrobenzoyl chloride structure
|
Common Name | 3-Methyl-4-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 35675-46-8 | Molecular Weight | 199.59100 | |
| Density | 1.386g/cm3 | Boiling Point | 299.2ºC at 760mmHg | |
| Molecular Formula | C8H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | 3-Methyl-4-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 299.2ºC at 760mmHg |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59100 |
| Flash Point | 134.7ºC |
| Exact Mass | 199.00400 |
| PSA | 62.89000 |
| LogP | 2.80540 |
| Index of Refraction | 1.579 |
| InChIKey | DUEGOHNPUBPUIV-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)Cl)ccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~%
3-Methyl-4-nitr... CAS#:35675-46-8 |
| Literature: Robertson; Beedle; Wilson; Parli; Smallwood; Steinberg Journal of Medicinal Chemistry, 1988 , vol. 31, # 7 p. 1290 - 1295 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoyl chloride,3-methyl-4-nitro |
| 3-Methyl-p-nitrobenzoyl chloride |
| 3-methyl-4-nitro-benzoic acid chloride |
| 3-Methyl-4-nitro-benzoylchlorid |
| 4-nitro-3-methyl-benzoylchloride |
| 3-Methyl-4-nitro-benzoyl chloride |
| EINECS 252-670-0 |