1-[2-(diethylamino)ethylamino]-4-methylxanthen-9-one structure
|
Common Name | 1-[2-(diethylamino)ethylamino]-4-methylxanthen-9-one | ||
|---|---|---|---|---|
| CAS Number | 3569-84-4 | Molecular Weight | 324.41700 | |
| Density | 1.162g/cm3 | Boiling Point | 493ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.9ºC | |
| Name | 1-[2-(diethylamino)ethylamino]-4-methylxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 493ºC at 760 mmHg |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.41700 |
| Flash Point | 251.9ºC |
| Exact Mass | 324.18400 |
| PSA | 45.48000 |
| LogP | 4.08130 |
| Index of Refraction | 1.61 |
| InChIKey | KHMPNHDYZSKNGR-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNc1ccc(C)c2oc3ccccc3c(=O)c12 |
| HS Code | 2932999099 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Miracil A |