1-[2-(diethylamino)ethylamino]-4-methyl-9H-xanthen-9-ol structure
|
Common Name | 1-[2-(diethylamino)ethylamino]-4-methyl-9H-xanthen-9-ol | ||
|---|---|---|---|---|
| CAS Number | 3569-85-5 | Molecular Weight | 326.43300 | |
| Density | 1.167g/cm3 | Boiling Point | 468.6ºC at 760 mmHg | |
| Molecular Formula | C20H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.2ºC | |
| Name | 1-[2-(diethylamino)ethylamino]-4-methyl-9H-xanthen-9-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 468.6ºC at 760 mmHg |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.43300 |
| Flash Point | 237.2ºC |
| Exact Mass | 326.19900 |
| PSA | 44.73000 |
| LogP | 4.00910 |
| Index of Refraction | 1.62 |
| InChIKey | HJUCSLDGPDCHNB-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNc1ccc(C)c2c1C(O)c1ccccc1O2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Miracil C |