Trimethoxy(4-methoxyphenyl)silane structure
|
Common Name | Trimethoxy(4-methoxyphenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 35692-27-4 | Molecular Weight | 228.317 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 228.9±23.0 °C at 760 mmHg | |
| Molecular Formula | C10H16O4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 72.3±23.0 °C | |
| Name | trimethoxy-(4-methoxyphenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 228.9±23.0 °C at 760 mmHg |
| Molecular Formula | C10H16O4Si |
| Molecular Weight | 228.317 |
| Flash Point | 72.3±23.0 °C |
| Exact Mass | 228.081787 |
| PSA | 36.92000 |
| LogP | 1.31 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.476 |
| InChIKey | ZESWBFKRPIRQCD-UHFFFAOYSA-N |
| SMILES | COc1ccc([Si](OC)(OC)OC)cc1 |
| HS Code | 2931900090 |
|---|
|
~%
Trimethoxy(4-me... CAS#:35692-27-4 |
| Literature: Journal of the American Chemical Society, , vol. 122, # 31 p. 7600 - 7601 |
|
~%
Trimethoxy(4-me... CAS#:35692-27-4 |
| Literature: Chemical Communications, , # 14 p. 1309 - 1310 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Trimethoxy(4-methoxyphenyl)silane |
| p-methoxyphenyltrimethoxysilane |
| 4-METHOXYPHENYLTRIMETHOXYSILANE |
| 4-(Trimethoxysilyl)anisole |
| 4-anisolyl trimethoxysilane |