4,4'-Dimethoxybiphenyl structure
|
Common Name | 4,4'-Dimethoxybiphenyl | ||
|---|---|---|---|---|
| CAS Number | 2132-80-1 | Molecular Weight | 214.26000 | |
| Density | 1.056 g/cm3 | Boiling Point | 338.4ºC at 760 mmHg | |
| Molecular Formula | C14H14O2 | Melting Point | 179-180 °C (subl.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 137.4ºC | |
| Name | 1-methoxy-4-(4-methoxyphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.056 g/cm3 |
|---|---|
| Boiling Point | 338.4ºC at 760 mmHg |
| Melting Point | 179-180 °C (subl.)(lit.) |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26000 |
| Flash Point | 137.4ºC |
| Exact Mass | 214.09900 |
| PSA | 18.46000 |
| LogP | 3.37080 |
| Vapour Pressure | 0.000193mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | UIMPAOAAAYDUKQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccc(OC)cc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Single-crystal X-ray diffraction, isolated-molecule and cluster electronic structure calculations, and scanning electron microscopy in an organic solid: models for intramolecular motion in 4,4'-dimethoxybiphenyl.
ChemPhysChem 13(8) , 2082-9, (2012) This paper brings together field emission scanning electron microscopy, single-crystal X-ray diffraction, and density functional electronic structure calculations in both an isolated molecule and a cl... |
| MFCD00008402 |
| 4,4'-dimethoxybiphenyl |
| p-MeO-Ph-Ph-p-OMe |
| 4,4'-diMeOBP |
| 4,4'-Dimethoxy-1,1'-biphenyl |
| 4,4′-Dimethoxybiphenyl |
| 4'-methoxy-(1,1'-biphenyl)-4-yl methyl ether |
| 4,4'-Bianisole |
| 4-(4-methoxyphenyl)anisole |
| 1,1'-Biphenyl,4,4'-dimethoxy |