Benzenamine,4-[(4-aminophenyl)sulfonyl]-N-ethyl structure
|
Common Name | Benzenamine,4-[(4-aminophenyl)sulfonyl]-N-ethyl | ||
|---|---|---|---|---|
| CAS Number | 3572-34-7 | Molecular Weight | 276.35400 | |
| Density | 1.279g/cm3 | Boiling Point | 503.9ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.6ºC | |
| Name | 4-[4-(ethylamino)phenyl]sulfonylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 503.9ºC at 760 mmHg |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.35400 |
| Flash Point | 258.6ºC |
| Exact Mass | 276.09300 |
| PSA | 80.57000 |
| LogP | 4.26840 |
| Index of Refraction | 1.629 |
| InChIKey | JQVXSWNILDNAJT-UHFFFAOYSA-N |
| SMILES | CCNc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1 |
| HS Code | 2921590090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Aminophenyl-4'-ethylaminophenylsulfon |
| 4-aminophenyl 4-ethylaminophenyl sulphone |
| N-Aethyl-4,4'-sulfonyl-di-anilin |