methyl 2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate structure
|
Common Name | methyl 2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 357263-49-1 | Molecular Weight | 204.18200 | |
| Density | 1.392g/cm3 | Boiling Point | 399.1ºC at 760mmHg | |
| Molecular Formula | C10H8N2O3 | Melting Point | 165-168ºC | |
| MSDS | USA | Flash Point | 195.1ºC | |
| Name | methyl 2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 399.1ºC at 760mmHg |
| Melting Point | 165-168ºC |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18200 |
| Flash Point | 195.1ºC |
| Exact Mass | 204.05300 |
| PSA | 72.05000 |
| LogP | 0.91860 |
| Index of Refraction | 1.643 |
| InChIKey | LXGPNHJNIRDJER-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)c1c[nH]c2ncccc12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~78%
methyl 2-oxo-2-... CAS#:357263-49-1 |
| Literature: Zhang, Zhongxing; Yang, Zhong; Wong, Henry; Zhu, Juliang; Meanwell, Nicholas A.; Kadow, John F.; Wang, Tao Journal of Organic Chemistry, 2002 , vol. 67, # 17 p. 6226 - 6227 |
|
~%
methyl 2-oxo-2-... CAS#:357263-49-1 |
| Literature: WO2007/68418 A1, ; Page/Page column 44 ; WO 2007/068418 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl7-Azaindole-3-glyoxylate |
| methyl 7-azaindole-3-glyoxylate |