Glycine,N-(2-hydroxy-3-nitrobenzoyl)- structure
|
Common Name | Glycine,N-(2-hydroxy-3-nitrobenzoyl)- | ||
|---|---|---|---|---|
| CAS Number | 35748-38-0 | Molecular Weight | 240.17000 | |
| Density | 1.588g/cm3 | Boiling Point | 466.3ºC at 760mmHg | |
| Molecular Formula | C9H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8ºC | |
| Name | 2-[(2-hydroxy-3-nitrobenzoyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.588g/cm3 |
|---|---|
| Boiling Point | 466.3ºC at 760mmHg |
| Molecular Formula | C9H8N2O6 |
| Molecular Weight | 240.17000 |
| Flash Point | 235.8ºC |
| Exact Mass | 240.03800 |
| PSA | 132.45000 |
| LogP | 1.02890 |
| Index of Refraction | 1.64 |
| InChIKey | ZKNYKRHOSGFPCY-UHFFFAOYSA-N |
| SMILES | O=C(O)CNC(=O)c1cccc([N+](=O)[O-])c1O |
|
~%
Glycine,N-(2-hy... CAS#:35748-38-0 |
| Literature: Schering Corporation and Pharmacopeia, Inc. Patent: US2004/147559 A1, 2004 ; Location in patent: Page 70 ; US 20040147559 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-(3-Nitrosalicyloyl)glycin |