methyl 2-[(2-hydroxy-3-nitro-benzoyl)amino]acetate structure
|
Common Name | methyl 2-[(2-hydroxy-3-nitro-benzoyl)amino]acetate | ||
|---|---|---|---|---|
| CAS Number | 35748-37-9 | Molecular Weight | 254.19600 | |
| Density | 1.439g/cm3 | Boiling Point | 400.2ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.8ºC | |
| Name | methyl 2-[(2-hydroxy-3-nitrobenzoyl)amino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 400.2ºC at 760 mmHg |
| Molecular Formula | C10H10N2O6 |
| Molecular Weight | 254.19600 |
| Flash Point | 195.8ºC |
| Exact Mass | 254.05400 |
| PSA | 121.45000 |
| LogP | 1.11730 |
| Index of Refraction | 1.587 |
| InChIKey | YJPSZLNNWRGXQE-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1O |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| METHYL 2-[(2-HYDROXY-3-NITRO-BENZOYL)AMINO]ACETATE |
| N-(3-Nitrosalicyloyl)glycinmethylester |