1,1-di(4-chlorophenyl)-2,2-dichlorocyclopropane structure
|
Common Name | 1,1-di(4-chlorophenyl)-2,2-dichlorocyclopropane | ||
|---|---|---|---|---|
| CAS Number | 3575-15-3 | Molecular Weight | 332.05200 | |
| Density | 1.46g/cm3 | Boiling Point | 409.1ºC at 760mmHg | |
| Molecular Formula | C15H10Cl4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201ºC | |
| Name | 1-chloro-4-[2,2-dichloro-1-(4-chlorophenyl)cyclopropyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 409.1ºC at 760mmHg |
| Molecular Formula | C15H10Cl4 |
| Molecular Weight | 332.05200 |
| Flash Point | 201ºC |
| Exact Mass | 329.95400 |
| LogP | 5.85710 |
| Index of Refraction | 1.649 |
| InChIKey | WXHRXSFGIXUNSQ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C2(c3ccc(Cl)cc3)CC2(Cl)Cl)cc1 |
| HS Code | 2903999090 |
|---|
|
~%
1,1-di(4-chloro... CAS#:3575-15-3 |
| Literature: Komrsova,H.; Farkas,J. Collection of Czechoslovak Chemical Communications, 1960 , vol. 25, p. 1977 - 1980 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,1-Dichlor-2,2-bis-<4-chlor-phenyl>-cyclopropan |