Benzene,1,1'-ethenylidenebis[4-chloro- structure
|
Common Name | Benzene,1,1'-ethenylidenebis[4-chloro- | ||
|---|---|---|---|---|
| CAS Number | 2642-81-1 | Molecular Weight | 249.13500 | |
| Density | 1.21g/cm3 | Boiling Point | 349.6ºC at 760mmHg | |
| Molecular Formula | C14H10Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159ºC | |
| Name | 1-chloro-4-[1-(4-chlorophenyl)ethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 349.6ºC at 760mmHg |
| Molecular Formula | C14H10Cl2 |
| Molecular Weight | 249.13500 |
| Flash Point | 159ºC |
| Exact Mass | 248.01600 |
| LogP | 5.05490 |
| Vapour Pressure | 9.38E-05mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | IEAUXBMXWDAYID-UHFFFAOYSA-N |
| SMILES | C=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| DMC ethylene |
| DDNU |