2-Amino-5-sulfobenzoic acid structure
|
Common Name | 2-Amino-5-sulfobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3577-63-7 | Molecular Weight | 217.199 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H7NO5S | Melting Point | 317ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-5-sulfobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Melting Point | 317ºC |
| Molecular Formula | C7H7NO5S |
| Molecular Weight | 217.199 |
| Exact Mass | 217.004486 |
| PSA | 126.07000 |
| LogP | 0.16 |
| Index of Refraction | 1.662 |
| InChIKey | MJNYPLCGWXFYPD-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)O)cc1C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-amino-3-carboxybenzenesulfonic acid |
| 5-Sulphoanthranilic acid |
| 1-amino-2-carboxybenzene-4-sulphonic acid |
| 5-Sulfoanthranilic acid |
| Benzoic acid, 2-amino-5-sulfo- |
| MFCD00035763 |
| EINECS 222-697-2 |
| 2-Amino-5-sulfobenzoic acid |
| 2-amino-5-sulfo-benzoic acid |
| 2-amino-5-sulpho-benzoic acid |
| 2-azanyl-5-sulfo-benzoic acid |
| Benzoic acid,2-amino-5-sulfo |
| 2-Amino-5-sulfo-benzoesaeure |
| 3-carboxy-4-amino-benzenesulphonic acid |