1-phenyl-2-pyridin-4-yl-ethane-1,2-dione structure
|
Common Name | 1-phenyl-2-pyridin-4-yl-ethane-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 35779-40-9 | Molecular Weight | 211.21600 | |
| Density | 1.216g/cm3 | Boiling Point | 372.3ºC at 760 mmHg | |
| Molecular Formula | C13H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | phenyl-pyridin-4-yl-ethanedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 372.3ºC at 760 mmHg |
| Molecular Formula | C13H9NO2 |
| Molecular Weight | 211.21600 |
| Flash Point | 182.4ºC |
| Exact Mass | 211.06300 |
| PSA | 47.03000 |
| LogP | 2.14720 |
| Index of Refraction | 1.599 |
| InChIKey | LXHDDNZEFUEFDI-UHFFFAOYSA-N |
| SMILES | O=C(C(=O)c1ccncc1)c1ccccc1 |
|
~29%
1-phenyl-2-pyri... CAS#:35779-40-9 |
| Literature: Wyeth Patent: US2007/4730 A1, 2007 ; Location in patent: Page/Page column 14-15 ; US 20070004730 A1 |
|
~18%
1-phenyl-2-pyri... CAS#:35779-40-9 |
| Literature: Andrews, Ian P.; Lewis, Norman J.; McKillop, Alexander; Wells, Andrew S. Heterocycles, 1994 , vol. 38, # 4 p. 713 - 718 |
|
~%
1-phenyl-2-pyri... CAS#:35779-40-9 |
| Literature: Buehler et al. Journal of Organic Chemistry, 1955 , vol. 20, p. 1350,1354 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-phenyl-2-pyridin-4-ylethane-1,2-dione |