2-nitro-1-nitroso-1-octylguanidine structure
|
Common Name | 2-nitro-1-nitroso-1-octylguanidine | ||
|---|---|---|---|---|
| CAS Number | 35799-08-7 | Molecular Weight | 245.27900 | |
| Density | 1.24g/cm3 | Boiling Point | 363.1ºC at 760 mmHg | |
| Molecular Formula | C9H19N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.4ºC | |
| Name | 2-nitro-1-nitroso-1-octylguanidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 363.1ºC at 760 mmHg |
| Molecular Formula | C9H19N5O3 |
| Molecular Weight | 245.27900 |
| Flash Point | 173.4ºC |
| Exact Mass | 245.14900 |
| PSA | 114.37000 |
| LogP | 3.06020 |
| Index of Refraction | 1.547 |
| InChIKey | AOZCQGYQFGAKBG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN(N=O)C(N)=N[N+](=O)[O-] |
| HS Code | 2925290090 |
|---|
|
~%
2-nitro-1-nitro... CAS#:35799-08-7 |
| Literature: Iwahara; Yanagimachi; Kamiya; Nakadate; Suzuki Chemical and pharmaceutical bulletin, 1971 , vol. 19, # 9 p. 1914 - 1918 |
|
~%
2-nitro-1-nitro... CAS#:35799-08-7 |
| Literature: Iwahara; Yanagimachi; Kamiya; Nakadate; Suzuki Chemical and pharmaceutical bulletin, 1971 , vol. 19, # 9 p. 1914 - 1918 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1-(n-Octyl)-3-nitro-1-nitrosoguanidin |
| N'-nitro-N-nitroso-N-octyl-guanidine |