N-dipropan-2-yloxyphosphoryl-3-methoxy-propan-1-amine structure
|
Common Name | N-dipropan-2-yloxyphosphoryl-3-methoxy-propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 35812-32-9 | Molecular Weight | 253.27600 | |
| Density | 1.027g/cm3 | Boiling Point | 295ºC at 760 mmHg | |
| Molecular Formula | C10H24NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.2ºC | |
| Name | N-di(propan-2-yloxy)phosphoryl-3-methoxypropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.027g/cm3 |
|---|---|
| Boiling Point | 295ºC at 760 mmHg |
| Molecular Formula | C10H24NO4P |
| Molecular Weight | 253.27600 |
| Flash Point | 132.2ºC |
| Exact Mass | 253.14400 |
| PSA | 66.60000 |
| LogP | 2.96150 |
| Index of Refraction | 1.432 |
| InChIKey | QMGZRPWKWBQJMU-UHFFFAOYSA-N |
| SMILES | COCCCNP(=O)(OC(C)C)OC(C)C |
|
~%
N-dipropan-2-yl... CAS#:35812-32-9 |
| Literature: Ryu,E.K.; Cates,L.A. Journal of Medicinal Chemistry, 1971 , vol. 14, p. 1022 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| dipropan-2-yl(3-methoxypropyl)phosphoramidate |