trifluoromethyl trifluoromethanesulfonate structure
|
Common Name | trifluoromethyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 3582-05-6 | Molecular Weight | 218.07500 | |
| Density | 1.791g/cm3 | Boiling Point | 21ºC | |
| Molecular Formula | C2F6O3S | Melting Point | -108.2ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trifluoromethyl trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.791g/cm3 |
|---|---|
| Boiling Point | 21ºC |
| Melting Point | -108.2ºC |
| Molecular Formula | C2F6O3S |
| Molecular Weight | 218.07500 |
| Exact Mass | 217.94700 |
| PSA | 51.75000 |
| LogP | 2.45320 |
| Index of Refraction | 1.297 |
| InChIKey | GVZFDPPAJXHNGL-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OC(F)(F)F)C(F)(F)F |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| trifluoromethanesulfonic acid trifluoromethylester |
| trifluoromethyl methanesulfonate |
| Trifluoromethyltriflate |
| Trifluormethyl trifluoromethanesulfonate |
| Methanesulfonicacid, 1,1,1-trifluoro-, trifluoromethyl ester |