α-[2-(Dimethylamino)ethyl]-α-isopropyl-2-naphthaleneacetamide structure
|
Common Name | α-[2-(Dimethylamino)ethyl]-α-isopropyl-2-naphthaleneacetamide | ||
|---|---|---|---|---|
| CAS Number | 3582-43-2 | Molecular Weight | 298.42300 | |
| Density | 1.061g/cm3 | Boiling Point | 482.6ºC at 760 mmHg | |
| Molecular Formula | C19H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.7ºC | |
| Name | 2-[2-(dimethylamino)ethyl]-3-methyl-2-naphthalen-2-ylbutanamide |
|---|
| Density | 1.061g/cm3 |
|---|---|
| Boiling Point | 482.6ºC at 760 mmHg |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.42300 |
| Flash Point | 245.7ºC |
| Exact Mass | 298.20500 |
| PSA | 47.32000 |
| LogP | 4.32030 |
| Index of Refraction | 1.574 |
| InChIKey | ZLNAZRUEULSTFP-UHFFFAOYSA-N |
| SMILES | CC(C)C(CCN(C)C)(C(N)=O)c1ccc2ccccc2c1 |
| HS Code | 2924299090 |
|---|
|
~%
α-[2-(Dimethyla... CAS#:3582-43-2 |
| Literature: Pala; Casadio; Bruzzese; Crescenzi; Marazzi-Uberti Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 698 - 700 |
|
~%
α-[2-(Dimethyla... CAS#:3582-43-2 |
| Literature: Pala; Casadio; Bruzzese; Crescenzi; Marazzi-Uberti Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 698 - 700 |
|
~%
α-[2-(Dimethyla... CAS#:3582-43-2 |
| Literature: Pala; Casadio; Bruzzese; Crescenzi; Marazzi-Uberti Journal of medicinal chemistry, 1965 , vol. 8, # 5 p. 698 - 700 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |