4-chloro-1,3-dimethyl-2,6-dioxo-pyrimidine-5-carbaldehyde structure
|
Common Name | 4-chloro-1,3-dimethyl-2,6-dioxo-pyrimidine-5-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 35824-85-2 | Molecular Weight | 202.59500 | |
| Density | 1.49g/cm3 | Boiling Point | 265.9ºC at 760 mmHg | |
| Molecular Formula | C7H7ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.6ºC | |
| Name | 4-chloro-1,3-dimethyl-2,6-dioxopyrimidine-5-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 265.9ºC at 760 mmHg |
| Molecular Formula | C7H7ClN2O3 |
| Molecular Weight | 202.59500 |
| Flash Point | 114.6ºC |
| Exact Mass | 202.01500 |
| PSA | 61.07000 |
| Index of Refraction | 1.58 |
| InChIKey | QETLJJSSAJXEIO-UHFFFAOYSA-N |
| SMILES | Cn1c(Cl)c(C=O)c(=O)n(C)c1=O |
| HS Code | 2933990090 |
|---|
|
~69%
4-chloro-1,3-di... CAS#:35824-85-2 |
| Literature: Decicco; Nelson Tetrahedron Letters, 1993 , vol. 34, # 51 p. 8213 - 8216 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-5-formyl-N,N-dimethyluracil |
| 6-Chloro-5-formyl-1,3-dimethyluracil |
| 6-Chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbaldehyde |
| 6-chloro-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxaldehyde |
| 6-chloro-1,2,3,4,-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinecarboxaldehyde |