6H-Benzofuro[3,2-c][1]benzopyran-6-one,3,9-bis(acetyloxy)- structure
|
Common Name | 6H-Benzofuro[3,2-c][1]benzopyran-6-one,3,9-bis(acetyloxy)- | ||
|---|---|---|---|---|
| CAS Number | 35826-57-4 | Molecular Weight | 352.29400 | |
| Density | 1.433g/cm3 | Boiling Point | 546.7ºC at 760mmHg | |
| Molecular Formula | C19H12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.4ºC | |
| Name | coumestrol diacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 546.7ºC at 760mmHg |
| Molecular Formula | C19H12O7 |
| Molecular Weight | 352.29400 |
| Flash Point | 284.4ºC |
| Exact Mass | 352.05800 |
| PSA | 95.95000 |
| LogP | 3.54300 |
| Index of Refraction | 1.638 |
| InChIKey | AHOLUZZXIVWXQQ-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc2c(c1)oc(=O)c1c3ccc(OC(C)=O)cc3oc21 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| O,O'-Diacetylcoumestrol |
| Coumestrol-diacetat |
| Coumestrol diacetate |
| (3-acetyloxy-6-oxo-[1]benzofuro[3,2-c]chromen-9-yl) acetate |
| 7,12-Diacetoxycoumestan |