2-(4-Methoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine structure
|
Common Name | 2-(4-Methoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 3584-23-4 | Molecular Weight | 421.922 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 462.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C12H7Cl6N3O | Melting Point | 145 °C | |
| MSDS | N/A | Flash Point | 233.3±31.5 °C | |
| Name | 2-(4-Methoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 462.2±55.0 °C at 760 mmHg |
| Melting Point | 145 °C |
| Molecular Formula | C12H7Cl6N3O |
| Molecular Weight | 421.922 |
| Flash Point | 233.3±31.5 °C |
| Exact Mass | 418.872040 |
| PSA | 47.90000 |
| LogP | 5.20 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | QRHHZFRCJDAUNA-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933699090 |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| EINECS 222-711-7 |
| MFCD00521486 |
| 4,6-Bis(trichloromethyl)-2-(4-methoxyphenyl)-1,3,5-triazine |
| 1,3,5-Triazine, 2-(4-methoxyphenyl)-4,6-bis(trichloromethyl)- |
| 2-(4-Methoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |