4-Bromo-2,8-bis(trifluoromethyl)quinoline structure
|
Common Name | 4-Bromo-2,8-bis(trifluoromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 35853-45-3 | Molecular Weight | 344.051 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 281.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H4BrF6N | Melting Point | 62-64ºC | |
| MSDS | N/A | Flash Point | 124.1±25.9 °C | |
| Name | 4-bromo-2,8-bis(trifluoromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 281.6±35.0 °C at 760 mmHg |
| Melting Point | 62-64ºC |
| Molecular Formula | C11H4BrF6N |
| Molecular Weight | 344.051 |
| Flash Point | 124.1±25.9 °C |
| Exact Mass | 342.943115 |
| PSA | 12.89000 |
| LogP | 3.84 |
| Appearance of Characters | Crystalline Powder | Off-white to yellow |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.510 |
| InChIKey | DXALAFAFIXJDOS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Br)c2cccc(C(F)(F)F)c2n1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
|
~98%
4-Bromo-2,8-bis... CAS#:35853-45-3 |
| Literature: Université de Picardie Jules Verne Patent: EP2487157 A1, 2012 ; Location in patent: Page/Page column 12 ; |
|
~82%
4-Bromo-2,8-bis... CAS#:35853-45-3 |
| Literature: Babu, Konda Ramesh; Eeshwaraiah, Begari; Aravind, Dachepally; Meshram, Harshadas M.; Raju, Rallabaldi Madhusudan; Bhattacharya, Apurba; Bandichhor, Rakeshwar Monatshefte fur Chemie, 2008 , vol. 139, # 2 p. 179 - 181 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Bromo-2,8-bis(trifluoromethyl)quinoline |
| Quinoline, 4-bromo-2,8-bis(trifluoromethyl)- |
| CC-PMLSC-DMA-P108 |
| QU177 |
| MFCD00075340 |
| 2,8-BIS(TRIFLUOROMETHYL)-4-BROMOQUINOLINE |
| 4-bromo-2,8-bistrifluoromethylquinoline |