3-chloro-1-(3,4-dichlorophenyl)propan-1-one structure
|
Common Name | 3-chloro-1-(3,4-dichlorophenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 35857-66-0 | Molecular Weight | 237.51000 | |
| Density | 1.374g/cm3 | Boiling Point | 358.2ºC at 760mmHg | |
| Molecular Formula | C9H7Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.3ºC | |
| Name | 3-chloro-1-(3,4-dichlorophenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 358.2ºC at 760mmHg |
| Molecular Formula | C9H7Cl3O |
| Molecular Weight | 237.51000 |
| Flash Point | 151.3ºC |
| Exact Mass | 235.95600 |
| PSA | 17.07000 |
| LogP | 3.80500 |
| Index of Refraction | 1.556 |
| InChIKey | ULARDXFALKMJAJ-UHFFFAOYSA-N |
| SMILES | O=C(CCCl)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2914700090 |
|---|
|
~86%
3-chloro-1-(3,4... CAS#:35857-66-0 |
| Literature: Zheng, Yong-Yong; Guo, Lin; Zhen, Xue-Chu; Li, Jian-Qi European Journal of Medicinal Chemistry, 2012 , vol. 54, p. 123 - 136 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3-Chloro-1-(3,4-dichlorophenyl)-1-propanone |
| 3-Chloro-1-(3,4-dichloro-phenyl)-propan-1-one |
| 3-Chlor-1-(3,4-dichlorphenyl)-1-propanon |