Vestitol structure
|
Common Name | Vestitol | ||
|---|---|---|---|---|
| CAS Number | 35878-41-2 | Molecular Weight | 272.296 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 418.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.9±28.7 °C | |
Use of Vestitol(-)-Vestitol is a compound isolated from Glycyrrhiza pallidiflora (Leguminosae)[1]. |
| Name | (-)-vestitol |
|---|---|
| Synonym | More Synonyms |
| Description | (-)-Vestitol is a compound isolated from Glycyrrhiza pallidiflora (Leguminosae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 418.5±45.0 °C at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.296 |
| Flash Point | 206.9±28.7 °C |
| Exact Mass | 272.104858 |
| PSA | 58.92000 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | XRVFNNUXNVWYTI-NSHDSACASA-N |
| SMILES | COc1ccc(C2COc3cc(O)ccc3C2)c(O)c1 |
| Hazard Codes | Xi |
|---|
| (3R)-3-(2-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| 2H-1-Benzopyran-7-ol, 3,4-dihydro-3-(2-hydroxy-4-methoxyphenyl)- |
| 3-(2-hydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol |
| 3-(2-Hydroxy-4-methoxyphenyl)-7-chromanol |
| UNII:Z244UVZ669 |
| 2H-1-Benzopyran-7-ol, 3,4-dihydro-3-(2-hydroxy-4-methoxyphenyl)-, (±)- |