Z-Phe-OMe structure
|
Common Name | Z-Phe-OMe | ||
|---|---|---|---|---|
| CAS Number | 35909-92-3 | Molecular Weight | 313.34800 | |
| Density | 1.181g/cm3 | Boiling Point | 478.5ºC at 760mmHg | |
| Molecular Formula | C18H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
Use of Z-Phe-OMeZ-L-phenylalanine methyl ester is a phenylalanine derivative[1]. |
| Name | methyl (2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Z-L-phenylalanine methyl ester is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 478.5ºC at 760mmHg |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.34800 |
| Flash Point | 243.2ºC |
| Exact Mass | 313.13100 |
| PSA | 64.63000 |
| LogP | 3.08800 |
| Index of Refraction | 1.562 |
| InChIKey | BBACSHIJBOGXKL-INIZCTEOSA-N |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Z-L-phenylalanine methyl ester |
| N-Benzyloxycarbonyl-L-phenylalanine methyl ester |
| Z-Phe-ome |
| Cbz-L-Phe-OMe |
| cbz-L-Phenylalanine methyl ester |
| N-Benzyloxycarbonylphenylalanine methyl ester |
| L-N-(benzyloxycarbonyl)phenylalanine methyl ester |
| L-Phenylalanine,N-((phenylmethoxy)carbonyl)-,methyl ester |
| N-Cbz-L-phenylalanine methyl ester |
| N-benzyloxycarbonyl-DL-phenylalanine methyl ester |
| methyl (S)-2-benzyloxycarbonylamino-3-phenylpropanoate |