Z-Asp-OMe
Z-Asp-OMe structure
|
Common Name | Z-Asp-OMe | ||
|---|---|---|---|---|
| CAS Number | 4668-42-2 | Molecular Weight | 281.261 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 498.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H15NO6 | Melting Point | 89.3ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | 255.6±28.7 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
Use of Z-Asp-OMeZ-Asp-OMe is an aspartic acid derivative[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| Synonym | More Synonyms |
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | Z-Asp-OMe is an aspartic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.9±45.0 °C at 760 mmHg |
| Melting Point | 89.3ºC (dec.) |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.261 |
| Flash Point | 255.6±28.7 °C |
| Exact Mass | 281.089935 |
| PSA | 101.93000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | MFFFBNAPQRDRQW-JTQLQIEISA-N |
| SMILES | COC(=O)C(CC(=O)O)NC(=O)OCc1ccccc1 |
| Storage condition | −20°C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318-H332 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R20/22;R37;R41 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 5 | |
CAS#:67-56-1
CAS#:4515-23-5
CAS#:4668-37-5
CAS#:1152-61-0
CAS#:57933-83-2
CAS#:79-22-1
CAS#:124-41-4
CAS#:23632-66-8
CAS#:63327-57-1
CAS#:15545-10-5
CAS#:5545-52-8
CAS#:17812-32-7
CAS#:21149-17-7
CAS#:39895-10-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-Carbobenzoxy-L-aspartic Acid 1-Methyl Ester |
| L-Aspartic acid, N-[(phenylmethoxy)carbonyl]-, 1-methyl ester |
| Z-Asp-Ome |
| Z-L-Aspartic acid 1-methyl ester |
| (S)-3-(((Benzyloxy)carbonyl)amino)-4-methoxy-4-oxobutanoic acid |
| (3S)-3-{[(Benzyloxy)carbonyl]amino}-4-methoxy-4-oxobutanoic acid |
| MFCD00083277 |
| N-Cbz-L-aspartic Acid 1-Methyl Ester |
| 1-Methyl N-Cbz-L-aspartate |
| Cbz-Asp-OMe |
| Cbz-L-aspartic acid 1-methyl ester |
| 1-Methyl N-Carbobenzoxy-L-aspartate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: InChIKey of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid is MFFFBNAPQRDRQW-JTQLQIEISA-N. |
| Q: What are the upstream materials of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: Related upstream materials(CAS) of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid: 67-56-1;4515-23-5;4668-37-5;1152-61-0;57933-83-2;79-22-1;124-41-4;23632-66-8;63327-57-1;15545-10-5. |
| Q: What is the safety information for (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: Safety information for (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid: S26-S36. |
| Q: What is the melting point of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: Melting point of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid is 89.3ºC (dec.). |
| Q: What is the molecular formula of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: Molecular formula of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid is C13H15NO6. |
| Q: What are the uses of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: Main uses of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid: Z-Asp-OMe is an aspartic acid derivative[1]. |
| Q: What is the molecular weight of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: Molecular weight of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid is 281.261. |
| Q: What is the English name of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: The English name of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid is (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid. |
| Q: What is the polar surface area (PSA) of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: Polar surface area (PSA) of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid is 101.93000. |
| Q: What is the CAS number of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid? |
| A: CAS number of (3S)-4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butanoic acid is 4668-42-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |