Pterosin C structure
|
Common Name | Pterosin C | ||
|---|---|---|---|---|
| CAS Number | 35938-43-3 | Molecular Weight | 234.29 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 448.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C14H18O3 | Melting Point | 152-155℃ | |
| MSDS | N/A | Flash Point | 239.0±25.2 °C | |
Use of Pterosin C(2S,3S)-Pterosin C is a natural sesquiterpenoid compound[1]. |
| Name | (2S,3S)-3-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-2,3-dihydro-1H-inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | (2S,3S)-Pterosin C is a natural sesquiterpenoid compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 448.2±45.0 °C at 760 mmHg |
| Melting Point | 152-155℃ |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 |
| Flash Point | 239.0±25.2 °C |
| Exact Mass | 234.125595 |
| PSA | 57.53000 |
| LogP | 1.23 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | QQPCNRKHGFIVLH-ZANVPECISA-N |
| SMILES | Cc1cc2c(c(C)c1CCO)C(=O)C(C)C2O |
| Hazard Codes | Xi |
|---|
| 1H-Inden-1-one, 2,3-dihydro-3-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-, (2S,3S)- |
| (2S,3S)-3-Hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-1-indanone |