1,3-Propanedione, 1,3-bis(4-methylphenyl)
1,3-Propanedione, 1,3-bis(4-methylphenyl) structure
|
Common Name | 1,3-Propanedione, 1,3-bis(4-methylphenyl) | ||
|---|---|---|---|---|
| CAS Number | 3594-36-3 | Molecular Weight | 252.30800 | |
| Density | 1.099g/cm3 | Boiling Point | 425.3ºC at 760mmHg | |
| Molecular Formula | C17H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-bis(4-methylphenyl)propane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 425.3ºC at 760mmHg |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.30800 |
| Flash Point | 159ºC |
| Exact Mass | 252.11500 |
| PSA | 34.14000 |
| LogP | 3.75910 |
| Index of Refraction | 1.572 |
| InChIKey | XKFZOWRFWMXGQG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CC(=O)c2ccc(C)cc2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2914399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 10 | |
CAS#:99-75-2
CAS#:122-00-9
CAS#:874-60-2
CAS#:123-54-6
CAS#:94-08-6
CAS#:104-87-0
CAS#:99-94-5
CAS#:108-88-3
CAS#:1663-67-8
CAS#:3457-48-5
CAS#:5333-22-2
CAS#:27450-45-9
CAS#:6833-18-7
CAS#:1377927-30-4
CAS#:62827-73-0
CAS#:61737-10-8This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-di-(4-methylphenyl)-1,3-propanedione |
| 1,3-bis(p-methylphenyl)-1,3-propanedione |
| 1,3-Di-(4-tolyl)-propane-1,3-dione |
| 1,3-Propanedione,1,3-bis(4-methylphenyl) |
| 1,3-bis(4-methylphenyl)propan-1,3-dione |
| 1,3-Bis(4'-methylphenyl)-1,3-propanedione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 1,3-bis(4-methylphenyl)propane-1,3-dione? |
| A: Related downstream products(CAS) of 1,3-bis(4-methylphenyl)propane-1,3-dione: 122-00-9;3457-48-5;99-75-2;5333-22-2;27450-45-9;99-94-5;6833-18-7;1377927-30-4;62827-73-0;61737-10-8. |
| Q: What English synonyms does 1,3-bis(4-methylphenyl)propane-1,3-dione have? |
| A: English synonyms of 1,3-bis(4-methylphenyl)propane-1,3-dione: 1,3-di-(4-methylphenyl)-1,3-propanedione, 1,3-bis(p-methylphenyl)-1,3-propanedione, 1,3-Di-(4-tolyl)-propane-1,3-dione, 1,3-Propanedione,1,3-bis(4-methylphenyl), 1,3-bis(4-methylphenyl)propan-1,3-dione, 1,3-Bis(4'-methylphenyl)-1,3-propanedione. |
| Q: What is the LogP of 1,3-bis(4-methylphenyl)propane-1,3-dione? |
| A: LogP of 1,3-bis(4-methylphenyl)propane-1,3-dione is 3.75910. |
| Q: What is the CAS number of 1,3-bis(4-methylphenyl)propane-1,3-dione? |
| A: CAS number of 1,3-bis(4-methylphenyl)propane-1,3-dione is 3594-36-3. |
| Q: What is the molecular weight of 1,3-bis(4-methylphenyl)propane-1,3-dione? |
| A: Molecular weight of 1,3-bis(4-methylphenyl)propane-1,3-dione is 252.30800. |
| Q: What are the upstream materials of 1,3-bis(4-methylphenyl)propane-1,3-dione? |
| A: Related upstream materials(CAS) of 1,3-bis(4-methylphenyl)propane-1,3-dione: 99-75-2;122-00-9;874-60-2;123-54-6;94-08-6;104-87-0;99-94-5;108-88-3;1663-67-8. |
| Q: What is the boiling point of 1,3-bis(4-methylphenyl)propane-1,3-dione? |
| A: Boiling point of 1,3-bis(4-methylphenyl)propane-1,3-dione is 425.3ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of 1,3-bis(4-methylphenyl)propane-1,3-dione? |
| A: Polar surface area (PSA) of 1,3-bis(4-methylphenyl)propane-1,3-dione is 34.14000. |
| Q: What is the SMILES notation of 1,3-bis(4-methylphenyl)propane-1,3-dione? |
| A: SMILES notation of 1,3-bis(4-methylphenyl)propane-1,3-dione is Cc1ccc(C(=O)CC(=O)c2ccc(C)cc2)cc1. |
| Q: What is the Chinese name of 3594-36-3? |
| A: Chinese name of 3594-36-3 is 3594-36-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |