2-methylbut-3-en-2-ol,4-nitrobenzoic acid structure
|
Common Name | 2-methylbut-3-en-2-ol,4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 35945-67-6 | Molecular Weight | 253.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methylbut-3-en-2-ol,4-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15NO5 |
|---|---|
| Molecular Weight | 253.25100 |
| Exact Mass | 253.09500 |
| PSA | 103.35000 |
| LogP | 2.75950 |
| InChIKey | NDCNEXGLPXWDGR-UHFFFAOYSA-N |
| SMILES | C=CC(C)(C)O.O=C(O)c1ccc([N+](=O)[O-])cc1 |
|
~84%
2-methylbut-3-e... CAS#:35945-67-6 |
| Literature: In, Su Kim; Krische, Michael J. Organic Letters, 2008 , vol. 10, # 3 p. 513 - 515 |
|
~%
2-methylbut-3-e... CAS#:35945-67-6 |
| Literature: Hennion; Barrett Journal of the American Chemical Society, 1957 , vol. 79, p. 2146 |
|
~%
2-methylbut-3-e... CAS#:35945-67-6 |
| Literature: Straus; Kuehnel Chemische Berichte, 1933 , vol. 66, p. 1834,1839 |
| 2-Methyl-3-buten-2-yl-p-nitrobenzoat |
| 3-Buten-2-ol,2-methyl-,4-nitrobenzoate |
| 4-nitro-benzoic acid-(1,1-dimethyl-allyl ester) |
| 2-methylbut-3-en-2-yl 4-nitrobenzoate |
| 4-Nitro-benzoesaeure-(1,1-dimethyl-allylester) |