N-[4-(4-phenoxybutoxy)phenyl]acetamide structure
|
Common Name | N-[4-(4-phenoxybutoxy)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 35965-99-2 | Molecular Weight | 299.36400 | |
| Density | 1.132g/cm3 | Boiling Point | 522.2ºC at 760 mmHg | |
| Molecular Formula | C18H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.6ºC | |
| Name | N-[4-(4-phenoxybutoxy)phenyl]acetamide |
|---|
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 522.2ºC at 760 mmHg |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.36400 |
| Flash Point | 269.6ºC |
| Exact Mass | 299.15200 |
| PSA | 47.56000 |
| LogP | 3.95600 |
| Index of Refraction | 1.574 |
| InChIKey | UZVOAZYVEPLQIN-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(OCCCCOc2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
N-[4-(4-phenoxy... CAS#:35965-99-2 |
| Literature: Baker; Bramhall Journal of medicinal chemistry, 1972 , vol. 15, # 3 p. 235 - 237 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |