Androst-4-ene-17-carboxylicacid, 17-hydroxy-3,11-dioxo-, (17a)- (9CI) structure
|
Common Name | Androst-4-ene-17-carboxylicacid, 17-hydroxy-3,11-dioxo-, (17a)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 3597-44-2 | Molecular Weight | 346.41700 | |
| Density | 1.31g/cm3 | Boiling Point | 567.7ºC at 760 mmHg | |
| Molecular Formula | C20H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.2ºC | |
| Name | 17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,6,7,8,9,12,14,15,16-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 567.7ºC at 760 mmHg |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.41700 |
| Flash Point | 311.2ºC |
| Exact Mass | 346.17800 |
| PSA | 91.67000 |
| LogP | 2.51300 |
| Index of Refraction | 1.593 |
| InChIKey | CULWSMXOZXJGRW-UHFFFAOYSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2C(=O)CC2(C)C1CCC2(O)C(=O)O |
|
~%
Androst-4-ene-1... CAS#:3597-44-2 |
| Literature: Duke University Patent: US5646136 A1, 1997 ; |
|
~%
Androst-4-ene-1... CAS#:3597-44-2 |
| Literature: Caspi,E.; Zajac,H. Journal of the Chemical Society, 1964 , p. 586 - 591 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 17-hydroxy-3,11-dioxo-21-nor-pregnen-(4)-oic acid-(20) |
| 17-Hydroxy-3,11-dioxo-21-nor-pregnen-(4)-saeure-(20) |