2,2,2-Trifluoro-N-(3-fluoro-phenyl)-acetamide structure
|
Common Name | 2,2,2-Trifluoro-N-(3-fluoro-phenyl)-acetamide | ||
|---|---|---|---|---|
| CAS Number | 35980-21-3 | Molecular Weight | 207.12500 | |
| Density | 1.447g/cm3 | Boiling Point | 235.3ºC at 760 mmHg | |
| Molecular Formula | C8H5F4NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.1ºC | |
| Name | 2,2,2-trifluoro-N-(3-fluorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 235.3ºC at 760 mmHg |
| Molecular Formula | C8H5F4NO |
| Molecular Weight | 207.12500 |
| Flash Point | 96.1ºC |
| Exact Mass | 207.03100 |
| PSA | 32.59000 |
| LogP | 2.97600 |
| Index of Refraction | 1.484 |
| InChIKey | WWKUHNUESPCMSE-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(F)c1)C(F)(F)F |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| n-trifluoroacetyl-3-fluoroaniline |
| Trifluoracet-m-fluoranilid |
| Acetamide,N-(3-fluorophenyl)-2,2,2-trifluoro |
| m-Fluoro-trifluoroacetanilid |
| Acetamide,2,2,2-trifluoro-N-(3-fluorophenyl) |
| T0519-0997 |
| N-(m-fluorophenyl)trifluoroacetamide |
| 2,2,2-tris(fluoranyl)-N-(3-fluorophenyl)ethanamide |
| 2,2,2,3'-Tetrafluoroacetanilide |
| Acetanilide,2,2,2,3'-tetrafluoro |