1,4-DIBROMOHEXAFLUOROBUT-2-ENE
1,4-DIBROMOHEXAFLUOROBUT-2-ENE structure
|
Common Name | 1,4-DIBROMOHEXAFLUOROBUT-2-ENE | ||
|---|---|---|---|---|
| CAS Number | 360-87-2 | Molecular Weight | 321.84100 | |
| Density | 2.19g/cm3 | Boiling Point | 119.5ºC at 760mmHg | |
| Molecular Formula | C4Br2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 26.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.19g/cm3 |
|---|---|
| Boiling Point | 119.5ºC at 760mmHg |
| Molecular Formula | C4Br2F6 |
| Molecular Weight | 321.84100 |
| Flash Point | 26.1ºC |
| Exact Mass | 319.82700 |
| LogP | 4.11240 |
| Index of Refraction | 1.413 |
| InChIKey | BDJHSJLEJXRSSG-OWOJBTEDSA-N |
| SMILES | FC(=C(F)C(F)(F)Br)C(F)(F)Br |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903799090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:685-63-2
CAS#:680-17-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-dibromo-1,1,2,3,4,4-hexafluoro-but-2-ene |
| 1,4-dibromo-1,1,2,3,4,4-hexafluoro-2-butene |
| 2-Butene,1,4-dibromo-1,1,2,3,4,4-hexafluoro |
| 1,4-dibromohexafluoro-2-butene |
| 1,4-Dibrom-hexafluor-but-2-en |
| 1,4-Dibromohexafluorobut-2-ene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: SMILES notation of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene is FC(=C(F)C(F)(F)Br)C(F)(F)Br. |
| Q: What are the downstream products of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: Related downstream products(CAS) of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene: 680-17-1. |
| Q: What is the English name of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: The English name of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene is 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene. |
| Q: What is the LogP of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: LogP of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene is 4.11240. |
| Q: What is the CAS number of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: CAS number of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene is 360-87-2. |
| Q: What is the boiling point of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: Boiling point of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene is 119.5ºC at 760mmHg. |
| Q: What is the safety information for 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: Safety information for 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene: 26-36/37/39. |
| Q: What is the molecular formula of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: Molecular formula of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene is C4Br2F6. |
| Q: What is the molecular weight of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: Molecular weight of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene is 321.84100. |
| Q: What are the upstream materials of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene? |
| A: Related upstream materials(CAS) of 1,4-dibromo-1,1,2,3,4,4-hexafluorobut-2-ene: 685-63-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |