Pregn-5-en-20-yne-3,17-diol,(3b,17a) structure
|
Common Name | Pregn-5-en-20-yne-3,17-diol,(3b,17a) | ||
|---|---|---|---|---|
| CAS Number | 3604-60-2 | Molecular Weight | 314.46200 | |
| Density | 1.14g/cm3 | Boiling Point | 442.4ºC at 760mmHg | |
| Molecular Formula | C21H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | 17.α.-Pregn-5-en-20-yne-3.β.,17.β.-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 442.4ºC at 760mmHg |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.46200 |
| Flash Point | 197.7ºC |
| Exact Mass | 314.22500 |
| PSA | 40.46000 |
| LogP | 3.67440 |
| Index of Refraction | 1.58 |
| InChIKey | VGJUOWGYQZYCII-TVWVXWENSA-N |
| SMILES | C#CC1(O)CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 17alpha-ethynyl-3beta,17beta-dihydroxy-androst-5-ene |
| 17alpha-Ethynylandrost-5-ene-3beta,17beta-diol |
| 17A-PREGN-5-EN-20-YNE-3B,17-DIOL |