Diethyl 2-chloro-1,3-azulenedicarboxylate structure
|
Common Name | Diethyl 2-chloro-1,3-azulenedicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 36044-40-3 | Molecular Weight | 306.74100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-chloroazulene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15ClO4 |
|---|---|
| Molecular Weight | 306.74100 |
| Exact Mass | 306.06600 |
| PSA | 52.60000 |
| LogP | 3.79820 |
| InChIKey | SYHKOSYNMHYLPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c2cccccc-2c(C(=O)OCC)c1Cl |
| HS Code | 2917399090 |
|---|
|
~90%
Diethyl 2-chlor... CAS#:36044-40-3 |
| Literature: Chen, Arh-Hwang; Chiu, Shu-Ching; Kuo, Yu-Chen Synthetic Communications, 2003 , vol. 33, # 15 p. 2701 - 2707 |
|
~%
Diethyl 2-chlor... CAS#:36044-40-3 |
| Literature: McDonald,R.N.; Richmond,J.M. Journal of Organic Chemistry, 1975 , vol. 40, p. 1689 - 1694 |
|
~%
Diethyl 2-chlor... CAS#:36044-40-3 |
| Literature: Nozoe et al. Proceedings of the Japan Academy, 1956 , vol. 32, p. 349,351 |
| Precursor 3 | |
|---|---|
| DownStream 8 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Diethyl 2-chloro-1,3-azulenedicarboxylate |
| 2-chloro-1,3-diethoxycarbonylazulene |
| 2-chloro-azulene-1,3-dicarboxylic acid diethyl ester |
| 1,3-Azulenedicarboxylic acid,2-chloro-,diethyl ester |
| 2-Chlor-azulen-1,3-dicarbonsaeure-diaethylester |