diethyl 6-(2-phenylethynyl)azulene-1,3-dicarboxylate structure
|
Common Name | diethyl 6-(2-phenylethynyl)azulene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 75628-82-9 | Molecular Weight | 372.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 6-(2-phenylethynyl)azulene-1,3-dicarboxylate |
|---|
| Molecular Formula | C24H20O4 |
|---|---|
| Molecular Weight | 372.41300 |
| Exact Mass | 372.13600 |
| PSA | 52.60000 |
| LogP | 4.54460 |
| InChIKey | LQUFFLQUTKNEKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c2ccc(C#Cc3ccccc3)ccc1-2 |
|
~86%
diethyl 6-(2-ph... CAS#:75628-82-9 |
| Literature: Ito; Inabe; Okujima; Morita; Watanabe; Imafuku Tetrahedron Letters, 2000 , vol. 41, # 43 p. 8343 - 8347 |
|
~38%
diethyl 6-(2-ph... CAS#:75628-82-9 |
| Literature: Morita, Tadayoshi; Fujita, Taira; Takase, Kahei Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 6 p. 1647 - 1651 |