1-bromo-2-fluoro-3,5-dimethyl-4,6-dinitro-benzene structure
|
Common Name | 1-bromo-2-fluoro-3,5-dimethyl-4,6-dinitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 361-43-3 | Molecular Weight | 293.04700 | |
| Density | 1.764g/cm3 | Boiling Point | 317.8ºC at 760 mmHg | |
| Molecular Formula | C8H6BrFN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146ºC | |
| Name | 1-bromo-2-fluoro-3,5-dimethyl-4,6-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.764g/cm3 |
|---|---|
| Boiling Point | 317.8ºC at 760 mmHg |
| Molecular Formula | C8H6BrFN2O4 |
| Molecular Weight | 293.04700 |
| Flash Point | 146ºC |
| Exact Mass | 291.94900 |
| PSA | 91.64000 |
| LogP | 4.06780 |
| Index of Refraction | 1.598 |
| InChIKey | DMJSCTASERIQOR-UHFFFAOYSA-N |
| SMILES | Cc1c(F)c(Br)c([N+](=O)[O-])c(C)c1[N+](=O)[O-] |
|
~%
1-bromo-2-fluor... CAS#:361-43-3 |
| Literature: Kleiderer; Adams Journal of the American Chemical Society, 1931 , vol. 53, p. 1575,1579 |
|
~%
1-bromo-2-fluor... CAS#:361-43-3 |
| Literature: Kleiderer; Adams Journal of the American Chemical Society, 1931 , vol. 53, p. 1575,1579 |
| 1-Brom-2-fluor-3,5-dimethyl-4,6-dinitro-benzol |
| 1-bromo-2-fluoro-3,5-dimethyl-4,6-dinitro-benzene |