1,1'-Biphenyl,2,2'-difluoro-3,3',5,5'-tetramethyl-4,4',6,6'-tetranitro- structure
|
Common Name | 1,1'-Biphenyl,2,2'-difluoro-3,3',5,5'-tetramethyl-4,4',6,6'-tetranitro- | ||
|---|---|---|---|---|
| CAS Number | 567-81-7 | Molecular Weight | 426.28500 | |
| Density | 1.546g/cm3 | Boiling Point | 478.5ºC at 760 mmHg | |
| Molecular Formula | C16H12F2N4O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.2ºC | |
| Name | 1-fluoro-2-(2-fluoro-3,5-dimethyl-4,6-dinitrophenyl)-4,6-dimethyl-3,5-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.546g/cm3 |
|---|---|
| Boiling Point | 478.5ºC at 760 mmHg |
| Molecular Formula | C16H12F2N4O8 |
| Molecular Weight | 426.28500 |
| Flash Point | 243.2ºC |
| Exact Mass | 426.06200 |
| PSA | 183.28000 |
| LogP | 6.59100 |
| Index of Refraction | 1.616 |
| InChIKey | MYODFJUODZLJDM-UHFFFAOYSA-N |
| SMILES | Cc1c(F)c(-c2c(F)c(C)c([N+](=O)[O-])c(C)c2[N+](=O)[O-])c([N+](=O)[O-])c(C)c1[N+](=O)[O-] |
|
~%
1,1'-Biphenyl,2... CAS#:567-81-7 |
| Literature: Kleiderer; Adams Journal of the American Chemical Society, 1931 , vol. 53, p. 1575,1579 |
|
~%
1,1'-Biphenyl,2... CAS#:567-81-7 |
| Literature: Kleiderer; Adams Journal of the American Chemical Society, 1931 , vol. 53, p. 1575,1579 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2,2'-difluoro-3,5,3',5'-tetramethyl-4,6,4',6'-tetranitro-biphenyl |
| 2,2'-Difluor-3,5,3',5'-tetramethyl-4,6,4',6'-tetranitro-biphenyl |
| 2,2'-difluoro-3,3',5,5'-tetramethyl-4,4',6,6'-tetranitrobiphenyl |