1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-one structure
|
Common Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 3612-14-4 | Molecular Weight | 263.33200 | |
| Density | 1.095g/cm3 | Boiling Point | 396.1ºC at 760 mmHg | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4ºC | |
| Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]piperidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 396.1ºC at 760 mmHg |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.33200 |
| Flash Point | 193.4ºC |
| Exact Mass | 263.15200 |
| PSA | 38.77000 |
| LogP | 1.84910 |
| Index of Refraction | 1.527 |
| InChIKey | UANQOYWHAIDBHZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCN2CCC(=O)CC2)cc1OC |
| HS Code | 2933399090 |
|---|
|
~%
1-[2-(3,4-dimet... CAS#:3612-14-4 |
| Literature: Janssens; Torremans; Janssen; Stokbroekx; Luyckx Journal of Medicinal Chemistry, 1985 , vol. 28, # 12 p. 1925 - 1933 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(3,4-Dimethoxy-phenethyl)-4-piperidon |
| 1-(3,4-Dimethoxy-phenethyl)-piperidon-(4) |
| 1-(3,4-dimethoxy-phenethyl)-piperidin-4-one |
| 1-(3,4-Dimethoxyphenethyl)-4-piperidone |
| 4-Piperidone,1-(3,4-dimethoxyphenethyl) |
| 1-<2-(3,4-dimethoxyphenyl)ethyl>-4-piperidone |