4-(acetylamino)-N-[2-(diethylamino)ethyl]-2-methoxybenzamide structure
|
Common Name | 4-(acetylamino)-N-[2-(diethylamino)ethyl]-2-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 3614-38-8 | Molecular Weight | 243.08400 | |
| Density | 1.111g/cm3 | Boiling Point | 501.1ºC at 760 mmHg | |
| Molecular Formula | C8H12Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.8ºC | |
| Name | (3-acetyloxy-1,4-dichlorobutan-2-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.111g/cm3 |
|---|---|
| Boiling Point | 501.1ºC at 760 mmHg |
| Molecular Formula | C8H12Cl2O4 |
| Molecular Weight | 243.08400 |
| Flash Point | 256.8ºC |
| Exact Mass | 242.01100 |
| PSA | 52.60000 |
| LogP | 1.32740 |
| Index of Refraction | 1.546 |
| InChIKey | DOICERWTDRJLRV-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1ccc(NC(C)=O)cc1OC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-acetamido-N-(2-(diethylamino)ethyl)-2-methoxybenzamide |
| 2,3-Butanediol,1,4-dichloro-,2,3-diacetate |
| 2,3-Butanediol,1,4-dichloro-,diacetate |
| 1,4-dichlorobutane-2,3-diyl diacetate |
| 4-acetylamino-N-(2-diethylamino-ethyl)-2-methoxy-benzamide |