AmphotericinB
Modify Date: 2025-09-06 18:29:27
AmphotericinB structure
|
Common Name | AmphotericinB | ||
|---|---|---|---|---|
| CAS Number | 36148-89-7 | Molecular Weight | 938.106 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 1102.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C48H75NO17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 620.6±34.3 °C | |
Use of AmphotericinBAmphotericin B methyl ester is the methyl ester derivative of the polyene antibiotic Amphotericin B (A634250). Amphotericin B methyl ester is the cholesterol-binding compound possesses significant antifungal activity. Amphotericin B methyl ester disrupts HIV-1 particle production and potently inhibits HIV-1 replication[1][2]. |
| Name | amphotericin B methyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Amphotericin B methyl ester is the methyl ester derivative of the polyene antibiotic Amphotericin B (A634250). Amphotericin B methyl ester is the cholesterol-binding compound possesses significant antifungal activity. Amphotericin B methyl ester disrupts HIV-1 particle production and potently inhibits HIV-1 replication[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Amphotericin B methyl ester inhibits HIV-1 particle production with no significant effect on Gag binding to the plasma membrane, Gag association with lipid rafts, or Gag multimerization[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 1102.6±65.0 °C at 760 mmHg |
| Molecular Formula | C48H75NO17 |
| Molecular Weight | 938.106 |
| Flash Point | 620.6±34.3 °C |
| Exact Mass | 937.503479 |
| PSA | 308.61000 |
| LogP | 1.63 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | UAZIZEMIKKIBCA-TYVGYKFWSA-N |
| SMILES | COC(=O)C1C(O)CC2(O)CC(O)CC(O)C(O)CCC(O)CC(O)CC(=O)OC(C)C(C)C(O)C(C)C=CC=CC=CC=CC=CC=CC=CC(OC3OC(C)C(O)C(N)C3O)CC1O2 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1397-89-3| 35-Deoxy Amphotericin B Methyl |
| methylamphotericin b |
| methyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14,39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylate |
| Methyl (1R,3S,5R,6R,9R,11R,15S,16R,17R,18S,19E,21E,23E,25E,27E,29E,31E,33R,35S,36R,37S)-33-[(3-amino-3,6-dideoxy-β-D-mannopyranosyl)oxy]-1,3,5,6,9,11,17,37-octahydroxy-15,16,18-trimethyl-13-oxo-14, 39-dioxabicyclo[33.3.1]nonatriaconta-19,21,23,25,27,29,31-heptaene-36-carboxylate |