3-tert-butyl-2,2,6,6-tetramethylhept-4-yn-3-ol structure
|
Common Name | 3-tert-butyl-2,2,6,6-tetramethylhept-4-yn-3-ol | ||
|---|---|---|---|---|
| CAS Number | 36187-03-8 | Molecular Weight | 224.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-tert-butyl-2,2,6,6-tetramethylhept-4-yn-3-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H28O |
|---|---|
| Molecular Weight | 224.38200 |
| Exact Mass | 224.21400 |
| PSA | 20.23000 |
| LogP | 3.85920 |
| InChIKey | PPNVNQGQMNRXGN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C#CC(O)(C(C)(C)C)C(C)(C)C |
|
~%
3-tert-butyl-2,... CAS#:36187-03-8 |
| Literature: Crandall,J.K. et al. Journal of Organic Chemistry, 1974 , vol. 39, p. 1723 - 1729 |
|
~%
3-tert-butyl-2,... CAS#:36187-03-8 |
| Literature: Schiavelli,M.D. et al. Journal of the American Chemical Society, 1972 , vol. 94, p. 5061 - 5064 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-tert-butyl-2,2,6,6-tetramethyl-hept-4-yn-3-ol |
| 2,2,6,6-Tetramethyl-5-tert.-butylhept-3-in-5-ol |
| 4-Heptyn-3-ol,3-(1,1-dimethylethyl)-2,2,6,6-tetramethyl |
| 2,2,6,6-Tetramethyl-3-tert.-butyl-4-heptin-3-ol |