1-(4-methoxynaphthalen-1-yl)-2-methyl-propan-1-one structure
|
Common Name | 1-(4-methoxynaphthalen-1-yl)-2-methyl-propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 36198-81-9 | Molecular Weight | 228.28600 | |
| Density | 1.074g/cm3 | Boiling Point | 382.7ºC at 760 mmHg | |
| Molecular Formula | C15H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2ºC | |
| Name | 1-(4-methoxynaphthalen-1-yl)-2-methylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 382.7ºC at 760 mmHg |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.28600 |
| Flash Point | 173.2ºC |
| Exact Mass | 228.11500 |
| PSA | 26.30000 |
| LogP | 3.68710 |
| Index of Refraction | 1.573 |
| InChIKey | SQUQFSNXYGMSNJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)C(C)C)c2ccccc12 |
|
~%
1-(4-methoxynap... CAS#:36198-81-9 |
| Literature: Winstein et al. Journal of Organic Chemistry, 1946 , vol. 11, p. 215,216, 219 |
|
~%
1-(4-methoxynap... CAS#:36198-81-9 |
| Literature: Chapiro Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1952 , vol. 234, p. 2080 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(4-methoxy-[1]naphthyl)-2-methyl-propan-1-one |
| 1-isobutyl-1,4-dihydro-tetrazole-5-thione |
| 1-Isobutyryl-4-methoxy-naphthalin |
| 1-isobutyl-1H-tetrazole-5-thiol |