Withanoside IV structure
|
Common Name | Withanoside IV | ||
|---|---|---|---|---|
| CAS Number | 362472-81-9 | Molecular Weight | 782.911 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 974.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C40H62O15 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 292.8±27.8 °C | |
| Name | 156GUP486T |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 974.0±65.0 °C at 760 mmHg |
| Molecular Formula | C40H62O15 |
| Molecular Weight | 782.911 |
| Flash Point | 292.8±27.8 °C |
| Exact Mass | 782.408875 |
| LogP | 2.78 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | VUQQGHSDHGOYRH-IFUSOADVSA-N |
| SMILES | CC1=C(CO)C(=O)OC(C(C)C2CCC3C4CC=C5CC(OC6OC(COC7OC(CO)C(O)C(O)C7O)C(O)C(O)C6O)CC(O)C5(C)C4CCC23C)C1 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| Withanoside IV |
| (1α,3β,22R)-1,26-Dihydroxy-27-oxo-22,27-epoxyergosta-5,24-dien-3-yl 6-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| 156GUP486T |
| Ergosta-5,24-dien-26-one, 22,26-epoxy-3-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-1,27-dihydroxy-, (1α,3β,22R)- |